Difference between revisions of "CPD-10806"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)...")
(Created page with "Category:Gene == Gene Tiso_gene_9613 == * right end position: ** 12073 * transcription direction: ** POSITIVE * left end position: ** 9624 * centisome position: ** 78.1168...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] ==
+
== Gene Tiso_gene_9613 ==
−
* smiles:
+
* right end position:
−
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** 12073
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3-dehydro-6-hydroxyteasterone
+
** 9624
−
* molecular weight:
+
* centisome position:
−
** 448.685    
+
** 78.11688    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.14.13.8-RXN]]
−
* [[RXN-11535]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[CYCLOHEXANONE-MONOOXYGENASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-5961]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN66-81]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[CYCLOHEXANOL-OXIDATION-PWY]]
 +
* [[PWY-5947]]
 +
* [[PWY66-201]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=12073}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515138 102515138]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: left end position=9624}}
−
{{#set: inchi key=InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N}}
+
{{#set: centisome position=78.11688    }}
−
{{#set: common name=3-dehydro-6-hydroxyteasterone}}
+
{{#set: reaction associated=1.14.13.8-RXN|CYCLOHEXANONE-MONOOXYGENASE-RXN|RXN-5961|RXN66-81}}
−
{{#set: molecular weight=448.685    }}
+
{{#set: pathway associated=CYCLOHEXANOL-OXIDATION-PWY|PWY-5947|PWY66-201}}
−
{{#set: produced by=RXN-11535}}
+

Revision as of 15:38, 21 March 2018

Gene Tiso_gene_9613

  • right end position:
    • 12073
  • transcription direction:
    • POSITIVE
  • left end position:
    • 9624
  • centisome position:
    • 78.11688
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-10806&oldid=35338"