Difference between revisions of "RXN-14771"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] == * smiles: ** CCCCCC(O)[CH]=CC=O * inchi key: ** InChIKey=JVJFIQYAHPMBBX...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8228 RXN-8228] == * direction: ** LEFT-TO-RIGHT * common name: ** delphinidin 3-O-glucoside 5-O...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8228 RXN-8228] ==
* smiles:
+
* direction:
** CCCCCC(O)[CH]=CC=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N
+
 
* common name:
 
* common name:
** 4-hydroxy-2-nonenal
+
** delphinidin 3-O-glucoside 5-O-glucosyltransferase
* molecular weight:
+
* ec number:
** 156.224   
+
** [http://enzyme.expasy.org/EC/2.4.1.298 EC-2.4.1.298]
 
* Synonym(s):
 
* Synonym(s):
** 4HNE
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-13673]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-12575]][c] '''+''' 1 [[CPD-7117]][c] '''=>''' 1 [[CPD-7139]][c] '''+''' 1 [[UDP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 UDP-α-D-glucose[c] '''+''' 1 delphinidin-3-O-β-D-glucoside[c] '''=>''' 1 delphinidin 3,5-di-O-β-D-glucoside[c] '''+''' 1 UDP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3452]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-5307]], gentiodelphin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5307 PWY-5307]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283344 5283344]
+
{{#set: common name=delphinidin 3-O-glucoside 5-O-glucosyltransferase}}
* CHEMSPIDER:
+
{{#set: ec number=EC-2.4.1.298}}
** [http://www.chemspider.com/Chemical-Structure.4446465.html 4446465]
+
{{#set: gene associated=Tiso_gene_3452}}
* CHEBI:
+
{{#set: in pathway=PWY-5307}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32585 32585]
+
{{#set: reconstruction category=orthology}}
* METABOLIGHTS : MTBLC32585
+
{{#set: reconstruction source=orthology-athaliana}}
* HMDB : HMDB04362
+
{{#set: reconstruction tool=pantograph}}
{{#set: smiles=CCCCCC(O)[CH]=CC=O}}
+
{{#set: inchi key=InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N}}
+
{{#set: common name=4-hydroxy-2-nonenal}}
+
{{#set: molecular weight=156.224    }}
+
{{#set: common name=4HNE}}
+
{{#set: consumed by=RXN-13673}}
+

Revision as of 16:38, 21 March 2018

Reaction RXN-8228

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • delphinidin 3-O-glucoside 5-O-glucosyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 UDP-α-D-glucose[c] + 1 delphinidin-3-O-β-D-glucoside[c] => 1 delphinidin 3,5-di-O-β-D-glucoside[c] + 1 UDP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5307, gentiodelphin biosynthesis: PWY-5307
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links