Difference between revisions of "Tiso gene 14710"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CREATINASE-RXN CREATINASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expa...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CREATINASE-RXN CREATINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/3.5.3.3 EC-3.5.3.3] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CREATINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[SARCOSINE]][c] '''+''' 1 [[UREA]][c] |
− | == | + | * With common name(s): |
+ | ** 1 creatine[c] '''+''' 1 H2O[c] '''=>''' 1 sarcosine[c] '''+''' 1 urea[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14456]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[CRNFORCAT-PWY]], creatinine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=CRNFORCAT-PWY CRNFORCAT-PWY] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22456 22456] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01566 R01566] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P38487 P38487] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P19213 P19213] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-3.5.3.3}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_14456}} |
− | {{#set: | + | {{#set: in pathway=CRNFORCAT-PWY}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
+ | {{#set: reconstruction source=orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Revision as of 15:38, 21 March 2018
Contents
Reaction CREATINASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 creatine[c] + 1 H2O[c] => 1 sarcosine[c] + 1 urea[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14456
- Source: orthology-esiliculosus
Pathways
- CRNFORCAT-PWY, creatinine degradation I: CRNFORCAT-PWY
- 2 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links