Difference between revisions of "RXN-12669"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == * smiles: ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.11.18-RXN 3.4.11.18-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** methionine_aminopep...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.11.18-RXN 3.4.11.18-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** methionine_aminopeptidase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.4.11.18 EC-3.4.11.18] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[WATER]][c] '''+''' 1 [[Protein-With-N-Terminal-Met]][c] '''=>''' 1 [[Peptides-holder]][c] '''+''' 1 [[MET]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 a peptide with an N-terminal L-methionine[c] '''=>''' 1 a peptide[c] '''+''' 1 L-methionine[c] '''+''' 1 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_3182]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_4247]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_5715]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P38062 P38062] |
− | * | + | ** [http://www.uniprot.org/uniprot/P47418 P47418] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PM25 Q9PM25] |
− | * | + | ** [http://www.uniprot.org/uniprot/P28617 P28617] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P44421 P44421] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9UYT4 Q9UYT4] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0AE18 P0AE18] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P50579 P50579] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9JWK1 Q9JWK1] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q58725 Q58725] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P56218 P56218] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P19994 P19994] |
+ | ** [http://www.uniprot.org/uniprot/P22624 P22624] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A1X6 P0A1X6] | ||
+ | ** [http://www.uniprot.org/uniprot/P41392 P41392] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59509 Q59509] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01662 Q01662] | ||
+ | ** [http://www.uniprot.org/uniprot/P95963 P95963] | ||
+ | ** [http://www.uniprot.org/uniprot/P53579 P53579] | ||
+ | ** [http://www.uniprot.org/uniprot/P53581 P53581] | ||
+ | ** [http://www.uniprot.org/uniprot/P53580 P53580] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9FV49 Q9FV49] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9Z9J4 Q9Z9J4] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9RKR2 Q9RKR2] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=methionine_aminopeptidase}} | ||
+ | {{#set: ec number=EC-3.4.11.18}} | ||
+ | {{#set: gene associated=Tiso_gene_3182|Tiso_gene_4247|Tiso_gene_5715}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 15:39, 21 March 2018
Contents
Reaction 3.4.11.18-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- methionine_aminopeptidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Protein-With-N-Terminal-Met[c] => 1 Peptides-holder[c] + 1 MET[c] + 1 PROTON[c]
- With common name(s):
- 1 H2O[c] + 1 a peptide with an N-terminal L-methionine[c] => 1 a peptide[c] + 1 L-methionine[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3182
- Source: orthology-esiliculosus
- Gene: Tiso_gene_4247
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5715
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
- UNIPROT: