Difference between revisions of "Tiso gene 19716"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_14650 == * left end position: ** 3164 * transcription direction: ** NEGATIVE * right end position: ** 5465 * centisome position: ** 57.3708...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == * smiles: ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) * common name: ** β...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_14650 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] ==
−
* left end position:
+
* smiles:
−
** 3164
+
** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** β-L-arabinose 1-phosphate
−
* right end position:
+
* inchi key:
−
** 5465
+
** InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L
−
* centisome position:
+
* molecular weight:
−
** 57.370804    
+
** 228.095    
 
* Synonym(s):
 
* Synonym(s):
 +
** β-L-arabinose 1-P
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-15556]]
+
* [[UMPU]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3164}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244737 25244737]
−
{{#set: right end position=5465}}
+
* HMDB : HMDB12195
−
{{#set: centisome position=57.370804   }}
+
* CHEBI:
−
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57521 57521]
−
{{#set: pathway associated=PWY-7511}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03906 C03906]
 +
{{#set: smiles=C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)}}
 +
{{#set: common name=β-L-arabinose 1-phosphate}}
 +
{{#set: inchi key=InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L}}
 +
{{#set: molecular weight=228.095   }}
 +
{{#set: common name=β-L-arabinose 1-P}}
 +
{{#set: consumed by=UMPU}}

Revision as of 16:39, 21 March 2018

Metabolite CPD-1825

  • smiles:
    • C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)
  • common name:
    • β-L-arabinose 1-phosphate
  • inchi key:
    • InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L
  • molecular weight:
    • 228.095
  • Synonym(s):
    • β-L-arabinose 1-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19716&oldid=35466"