Difference between revisions of "Tiso gene 2144"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] == * smiles: ** COC1(=C(O)C=CC(C(O)CO)=C1) * inchi key: ** InChIKey=FBWPWW...") |
(Created page with "Category:Gene == Gene Tiso_gene_13177 == * right end position: ** 6389 * transcription direction: ** NEGATIVE * left end position: ** 1202 * centisome position: ** 18.5436...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13177 == |
− | * | + | * right end position: |
− | ** | + | ** 6389 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 1202 |
− | * | + | * centisome position: |
− | ** | + | ** 18.54366 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.6.3.1-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=6389}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=1202}} | |
− | + | {{#set: centisome position=18.54366 }} | |
− | + | {{#set: reaction associated=3.6.3.1-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:40, 21 March 2018
Gene Tiso_gene_13177
- right end position:
- 6389
- transcription direction:
- NEGATIVE
- left end position:
- 1202
- centisome position:
- 18.54366
- Synonym(s):
Reactions associated
- Reaction: 3.6.3.1-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation