Difference between revisions of "RNASE-III-PROCESSING-PRODUCT-MRNA"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10957 == * left end position: ** 4603 * transcription direction: ** POSITIVE * right end position: ** 6831 * centisome position: ** 56.2782...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == |
− | * | + | * smiles: |
− | ** | + | ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O |
− | * | + | * common name: |
− | ** | + | ** α,α-trehalose 6-phosphate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 420.263 |
* Synonym(s): | * Synonym(s): | ||
+ | ** α,α-D-trehalose 6-phosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[TREHALOSEPHOSPHA-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[UG6PGT]] | |
− | + | * [[UG6PGTn]] | |
− | + | * [[TREHALOSE6PSYN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 4484-88-2 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246105 25246105] |
− | {{#set: | + | * HMDB : HMDB01124 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00689 C00689] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58429 58429] | ||
+ | * BIGG : tre6p | ||
+ | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O}} | ||
+ | {{#set: common name=α,α-trehalose 6-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L}} | ||
+ | {{#set: molecular weight=420.263 }} | ||
+ | {{#set: common name=α,α-D-trehalose 6-phosphate}} | ||
+ | {{#set: consumed by=TREHALOSEPHOSPHA-RXN}} | ||
+ | {{#set: produced by=UG6PGT|UG6PGTn|TREHALOSE6PSYN-RXN}} |
Revision as of 15:40, 21 March 2018
Contents
Metabolite TREHALOSE-6P
- smiles:
- C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O
- common name:
- α,α-trehalose 6-phosphate
- inchi key:
- InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L
- molecular weight:
- 420.263
- Synonym(s):
- α,α-D-trehalose 6-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O" cannot be used as a page name in this wiki.