Difference between revisions of "RNASE-III-PROCESSING-PRODUCT-MRNA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10957 == * left end position: ** 4603 * transcription direction: ** POSITIVE * right end position: ** 6831 * centisome position: ** 56.2782...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-]...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_10957 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] ==
−
* left end position:
+
* smiles:
−
** 4603
+
** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** α,α-trehalose 6-phosphate
−
* right end position:
+
* inchi key:
−
** 6831
+
** InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L
−
* centisome position:
+
* molecular weight:
−
** 56.278275    
+
** 420.263    
 
* Synonym(s):
 
* Synonym(s):
 +
** α,α-D-trehalose 6-phosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ALANINE-AMINOTRANSFERASE-RXN]]
+
* [[TREHALOSEPHOSPHA-RXN]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[UG6PGT]]
−
** experimental_annotation
+
* [[UG6PGTn]]
−
***ec-number
+
* [[TREHALOSE6PSYN-RXN]]
−
* [[RXN-13698]]
+
== Reaction(s) of unknown directionality ==
−
** in-silico_annotation
+
−
***ec-number
+
−
** experimental_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[ALANINE-DEG3-PWY]]
+
−
* [[PWY-7383]]
+
−
* [[PWY-7117]]
+
−
* [[ALACAT2-PWY]]
+
−
* [[PWY-7115]]
+
−
* [[ALANINE-SYN2-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4603}}
+
* CAS : 4484-88-2
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=6831}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246105 25246105]
−
{{#set: centisome position=56.278275   }}
+
* HMDB : HMDB01124
−
{{#set: reaction associated=ALANINE-AMINOTRANSFERASE-RXN|RXN-13698}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=ALANINE-DEG3-PWY|PWY-7383|PWY-7117|ALACAT2-PWY|PWY-7115|ALANINE-SYN2-PWY}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00689 C00689]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58429 58429]
 +
* BIGG : tre6p
 +
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O}}
 +
{{#set: common name=α,α-trehalose 6-phosphate}}
 +
{{#set: inchi key=InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L}}
 +
{{#set: molecular weight=420.263   }}
 +
{{#set: common name=α,α-D-trehalose 6-phosphate}}
 +
{{#set: consumed by=TREHALOSEPHOSPHA-RXN}}
 +
{{#set: produced by=UG6PGT|UG6PGTn|TREHALOSE6PSYN-RXN}}

Revision as of 15:40, 21 March 2018

Metabolite TREHALOSE-6P

  • smiles:
    • C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O
  • common name:
    • α,α-trehalose 6-phosphate
  • inchi key:
    • InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L
  • molecular weight:
    • 420.263
  • Synonym(s):
    • α,α-D-trehalose 6-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 4484-88-2
  • PUBCHEM:
  • HMDB : HMDB01124
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : tre6p
"C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RNASE-III-PROCESSING-PRODUCT-MRNA&oldid=35571"