Difference between revisions of "Tiso gene 12535"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=B...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] == * smiles: ** COC1(=C(O)C=CC(C(O)CO)=C1) * common name: ** 3-methoxy-4-h...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] == |
* smiles: | * smiles: | ||
− | ** | + | ** COC1(=C(O)C=CC(C(O)CO)=C1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-methoxy-4-hydroxyphenylglycol |
+ | * inchi key: | ||
+ | ** InChIKey=FBWPWWWZWKPJFL-QMMMGPOBSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 184.191 |
* Synonym(s): | * Synonym(s): | ||
+ | ** methoxyhydroxyphenylglycol | ||
+ | ** vanylglycol | ||
+ | ** MHPG piperazine | ||
+ | ** MHPG | ||
+ | ** MOPEG | ||
+ | ** methoxy-hydroxyphenyl glycol | ||
+ | ** 4-hydroxy-3-methoxyphenylglycol | ||
+ | ** hydroxymethoxyphenylglycol | ||
+ | ** HMPG | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-10915]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=688030 688030] |
− | * HMDB : | + | * CHEMSPIDER: |
− | {{#set: smiles= | + | ** [http://www.chemspider.com/Chemical-Structure.10348.html 10348] |
− | {{#set: | + | * HMDB : HMDB01490 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: molecular weight= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05594 C05594] |
− | {{#set: | + | {{#set: smiles=COC1(=C(O)C=CC(C(O)CO)=C1)}} |
+ | {{#set: common name=3-methoxy-4-hydroxyphenylglycol}} | ||
+ | {{#set: inchi key=InChIKey=FBWPWWWZWKPJFL-QMMMGPOBSA-N}} | ||
+ | {{#set: molecular weight=184.191 }} | ||
+ | {{#set: common name=methoxyhydroxyphenylglycol|vanylglycol|MHPG piperazine|MHPG|MOPEG|methoxy-hydroxyphenyl glycol|4-hydroxy-3-methoxyphenylglycol|hydroxymethoxyphenylglycol|HMPG}} | ||
+ | {{#set: reversible reaction associated=RXN-10915}} |
Revision as of 15:40, 21 March 2018
Contents
Metabolite CPD-11497
- smiles:
- COC1(=C(O)C=CC(C(O)CO)=C1)
- common name:
- 3-methoxy-4-hydroxyphenylglycol
- inchi key:
- InChIKey=FBWPWWWZWKPJFL-QMMMGPOBSA-N
- molecular weight:
- 184.191
- Synonym(s):
- methoxyhydroxyphenylglycol
- vanylglycol
- MHPG piperazine
- MHPG
- MOPEG
- methoxy-hydroxyphenyl glycol
- 4-hydroxy-3-methoxyphenylglycol
- hydroxymethoxyphenylglycol
- HMPG
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links