Difference between revisions of "2-ISOPROPYLMALATESYN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14387 RXN-14387] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14387 RXN-14387] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J
+
−
* common name:
+
−
** palmitoleoyl-CoA
+
−
* molecular weight:
+
−
** 999.899   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 16:1-delta9-CoA
 
−
** 9z-hexadecenoyl-CoA
 
−
** cis-9-hexadecenoyl-CoA
 
−
** palmitoleoyl coenzyme A
 
−
** (9Z)-hexadec-9-enoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17019]]
+
* With identifiers:
−
* [[RXN-17008]]
+
** 1 [[CD-2S-SP-Complex]][c] '''+''' 2 [[FE+3]][c] '''=>''' 1 [[CD-SP-2Fe2S-Complex]][c]
−
* [[RXN-17009]]
+
* With common name(s):
−
* [[RXN-17788]]
+
** 1 a [cysteine desulfurase]-(S-sulfanyl)2-[disordered-form scaffold protein] complex[c] '''+''' 2 Fe3+[c] '''=>''' 1 a [cysteine desulfurase]-[scaffold protein-(2Fe-2S)] complex[c]
−
== Reaction(s) known to produce the compound ==
+
 
−
* [[RXN-17787]]
+
== Genes associated with this reaction  ==
−
* [[RXN0-7248]]
+
Genes have been associated with this reaction based on different elements listed below.
−
== Reaction(s) of unknown directionality ==
+
* Gene: [[Tiso_gene_15502]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7250]], [2Fe-2S] iron-sulfur cluster biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250]
 +
** '''10''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244393 25244393]
+
{{#set: gene associated=Tiso_gene_15502}}
−
* CHEBI:
+
{{#set: in pathway=PWY-7250}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61540 61540]
+
{{#set: reconstruction category=orthology|annotation}}
−
* METABOLIGHTS : MTBLC61540
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
−
{{#set: smiles=CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: inchi key=InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J}}
+
−
{{#set: common name=palmitoleoyl-CoA}}
+
−
{{#set: molecular weight=999.899    }}
+
−
{{#set: common name=16:1-delta9-CoA|9z-hexadecenoyl-CoA|cis-9-hexadecenoyl-CoA|palmitoleoyl coenzyme A|(9Z)-hexadec-9-enoyl-CoA}}
+
−
{{#set: consumed by=RXN-17019|RXN-17008|RXN-17009|RXN-17788}}
+
−
{{#set: produced by=RXN-17787|RXN0-7248}}
+

Revision as of 15:41, 21 March 2018

Reaction RXN-14387

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a [cysteine desulfurase]-(S-sulfanyl)2-[disordered-form scaffold protein] complex[c] + 2 Fe3+[c] => 1 a [cysteine desulfurase]-[scaffold protein-(2Fe-2S)] complex[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7250, [2Fe-2S] iron-sulfur cluster biosynthesis: PWY-7250
    • 10 reactions found over 10 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2-ISOPROPYLMALATESYN-RXN&oldid=35596"