Difference between revisions of "RXN-10773"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17273 CPD-17273] == * smiles: ** CCCCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCCCCCCC)COP([O-])(=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17273 CPD-17273] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCCCCCCC)COP([O-])(=O)[O-])=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 1-stearoyl-2-palmitoyl-sn-glycerol 3-phosphate |
| + | * inchi key: | ||
| + | ** InChIKey=USQMHZSVXZAKAI-PGUFJCEWSA-L | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 674.937 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16025]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-16030]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819963 91819963] |
| − | + | {{#set: smiles=CCCCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCCCCCCC)COP([O-])(=O)[O-])=O}} | |
| − | + | {{#set: common name=1-stearoyl-2-palmitoyl-sn-glycerol 3-phosphate}} | |
| − | + | {{#set: inchi key=InChIKey=USQMHZSVXZAKAI-PGUFJCEWSA-L}} | |
| − | {{#set: smiles= | + | {{#set: molecular weight=674.937 }} |
| − | {{#set: | + | {{#set: produced by=RXN-16025}} |
| − | {{#set: | + | {{#set: reversible reaction associated=RXN-16030}} |
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:41, 21 March 2018
Contents
Metabolite CPD-17273
- smiles:
- CCCCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCCCCCCC)COP([O-])(=O)[O-])=O
- common name:
- 1-stearoyl-2-palmitoyl-sn-glycerol 3-phosphate
- inchi key:
- InChIKey=USQMHZSVXZAKAI-PGUFJCEWSA-L
- molecular weight:
- 674.937
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCCCCCCCCC)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.
