Difference between revisions of "Tiso gene 6869"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_12341 == * Synonym(s): == Reactions associated == * RXN-1224 ** pantograph-esiliculosus * RXN-15117 ** pantograph-at...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_12341 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] ==
 +
* smiles:
 +
** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
 +
* common name:
 +
** tetrahydrogeranylgeranyl diphosphate
 +
* inchi key:
 +
** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
 +
* molecular weight:
 +
** 451.456   
 
* Synonym(s):
 
* Synonym(s):
 +
** tetrahydroGGPP
 +
** tetrahydrogeranylgeranyl pyrophosphate
 +
** tetrahydrogeranylgeranyl-PP
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-1224]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-15117]]
+
* [[RXN-7659]]
** [[pantograph]]-[[athaliana]]
+
* [[RXN-7660]]
== Pathways associated ==
+
* [[PWY-7817]]
+
* [[PWYQT-4427]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-1224|RXN-15117}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-7817|PWYQT-4427}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275]
 +
{{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
 +
{{#set: common name=tetrahydrogeranylgeranyl diphosphate}}
 +
{{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}}
 +
{{#set: molecular weight=451.456    }}
 +
{{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}}
 +
{{#set: reversible reaction associated=RXN-7659|RXN-7660}}

Revision as of 16:41, 21 March 2018

Metabolite CPD-7003

  • smiles:
    • CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
  • common name:
    • tetrahydrogeranylgeranyl diphosphate
  • inchi key:
    • InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
  • molecular weight:
    • 451.456
  • Synonym(s):
    • tetrahydroGGPP
    • tetrahydrogeranylgeranyl pyrophosphate
    • tetrahydrogeranylgeranyl-PP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.