Difference between revisions of "Tiso gene 9874"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-747 RXN0-747] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-diphosphate_re...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-747 RXN0-747] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
+
 
* common name:
 
* common name:
−
** dGTP
+
** ribonucleoside-diphosphate_reductase
−
* molecular weight:
+
* ec number:
−
** 503.152   
+
** [http://enzyme.expasy.org/EC/1.17.4.1 EC-1.17.4.1]
 
* Synonym(s):
 
* Synonym(s):
−
** 2'-deoxyguanosine-5'-triphosphate
 
−
** deoxy-GTP
 
−
** deoxyguanosine-triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[DGTCY]]
+
* With identifiers:
−
* [[DGTUP]]
+
** 1 [[ADP]][c] '''+''' 1 [[Reduced-NrdH-Proteins]][c] '''=>''' 1 [[Oxidized-NrdH-Proteins]][c] '''+''' 1 [[DADP]][c] '''+''' 1 [[WATER]][c]
−
* [[RXN0-385]]
+
* With common name(s):
−
* [[RME255]]
+
** 1 ADP[c] '''+''' 1 a reduced NrdH glutaredoxin-like protein[c] '''=>''' 1 an oxidized NrdH glutaredoxin-like protein[c] '''+''' 1 dADP[c] '''+''' 1 H2O[c]
−
* [[RXN-11410]]
+
 
−
* [[RXN-14208]]
+
== Genes associated with this reaction  ==
−
* [[RXN-14217]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[DGTD]]
+
* Gene: [[Tiso_gene_9916]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[ATDGD]]
+
*** Assignment: EC-NUMBER
−
* [[DGDPKIN-RXN]]
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Gene: [[Tiso_gene_10138]]
−
* [[RXN-14207]]
+
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_10617]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_9915]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7220]], adenosine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7220 PWY-7220]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2564-35-4
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=ribonucleoside-diphosphate_reductase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246112 25246112]
+
{{#set: ec number=EC-1.17.4.1}}
−
* HMDB : HMDB01440
+
{{#set: gene associated=Tiso_gene_9916|Tiso_gene_10138|Tiso_gene_10617|Tiso_gene_9915}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7220}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00286 C00286]
+
{{#set: reconstruction category=orthology|annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61429 61429]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
* BIGG : dgtp
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J}}
+
−
{{#set: common name=dGTP}}
+
−
{{#set: molecular weight=503.152    }}
+
−
{{#set: common name=2'-deoxyguanosine-5'-triphosphate|deoxy-GTP|deoxyguanosine-triphosphate}}
+
−
{{#set: consumed by=DGTCY|DGTUP|RXN0-385|RME255|RXN-11410|RXN-14208|RXN-14217|DGTD}}
+
−
{{#set: produced by=ATDGD|DGDPKIN-RXN}}
+
−
{{#set: reversible reaction associated=RXN-14207}}
+

Revision as of 15:42, 21 March 2018

Reaction RXN0-747

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ribonucleoside-diphosphate_reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7220, adenosine deoxyribonucleotides de novo biosynthesis II: PWY-7220
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9874&oldid=35702"