Difference between revisions of "Tiso gene 17798"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Triacylglycerols Triacylglycerols] == * common name: ** a triacyl-sn-glycerol * Synonym(s): ==...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * common name: ** aldehydo-D-ma...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Triacylglycerols Triacylglycerols] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] ==
 +
* smiles:
 +
** [CH](=O)C(O)C(O)C(O)C(O)CO
 
* common name:
 
* common name:
** a triacyl-sn-glycerol
+
** aldehydo-D-mannose
 +
* inchi key:
 +
** InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N
 +
* molecular weight:
 +
** 180.157   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14501]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
 
* [[RXN-1641]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-12383]]
+
* [[1.1.1.255-RXN]]
 +
* [[RXN-14500]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a triacyl-sn-glycerol}}
+
* PUBCHEM:
{{#set: produced by=DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN|RXN-1641}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161658 161658]
{{#set: reversible reaction associated=RXN-12383}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37675 37675]
 +
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)CO}}
 +
{{#set: common name=aldehydo-D-mannose}}
 +
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N}}
 +
{{#set: molecular weight=180.157    }}
 +
{{#set: consumed by=RXN-14501}}
 +
{{#set: reversible reaction associated=1.1.1.255-RXN|RXN-14500}}

Revision as of 15:43, 21 March 2018

Metabolite CPD-15373

  • smiles:
    • [CH](=O)C(O)C(O)C(O)C(O)CO
  • common name:
    • aldehydo-D-mannose
  • inchi key:
    • InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N
  • molecular weight:
    • 180.157
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.