Difference between revisions of "325-BISPHOSPHATE-NUCLEOTIDASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=S...")
(Created page with "Category:Gene == Gene Tiso_gene_15128 == * right end position: ** 1853 * transcription direction: ** POSITIVE * left end position: ** 14 * centisome position: ** 0.2683020...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] ==
+
== Gene Tiso_gene_15128 ==
−
* smiles:
+
* right end position:
−
** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))
+
** 1853
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (S)-nicotine
+
** 14
−
* molecular weight:
+
* centisome position:
−
** 163.242    
+
** 0.26830205    
 
* Synonym(s):
 
* Synonym(s):
−
** nicotine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-81]]
+
* Reaction: [[R524-RXN]]
−
* [[RXN66-146]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN66-83]]
+
*** Assignment: automated-name-match
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[RXN-12893]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[CYANCAT-PWY]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: right end position=1853}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=5065 5065]
+
{{#set: transcription direction=POSITIVE}}
−
* PUBCHEM:
+
{{#set: left end position=14}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6919000 6919000]
+
{{#set: centisome position=0.26830205   }}
−
* HMDB : HMDB01934
+
{{#set: reaction associated=R524-RXN|RXN-12893}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=CYANCAT-PWY}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00745 C00745]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5294163.html 5294163]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59806 59806]
+
−
{{#set: smiles=C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))}}
+
−
{{#set: inchi key=InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O}}
+
−
{{#set: common name=(S)-nicotine}}
+
−
{{#set: molecular weight=163.242   }}
+
−
{{#set: common name=nicotine}}
+
−
{{#set: consumed by=RXN66-81|RXN66-146|RXN66-83}}
+

Revision as of 15:43, 21 March 2018

Gene Tiso_gene_15128

  • right end position:
    • 1853
  • transcription direction:
    • POSITIVE
  • left end position:
    • 14
  • centisome position:
    • 0.26830205
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=325-BISPHOSPHATE-NUCLEOTIDASE-RXN&oldid=35892"