Difference between revisions of "Tiso gene 5939"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] == * smiles: ** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nitriles Nitriles] == * common name: ** a nitrile * Synonym(s): ** nitrile ** R-CN ** a nitrile...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1302 CPD-1302] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nitriles Nitriles] ==
−
* smiles:
+
−
** CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))
+
−
* inchi key:
+
−
** InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J
+
 
* common name:
 
* common name:
−
** N5-methyl--tetrahydropteroyl tri-L-glutamate
+
** a nitrile
−
* molecular weight:
+
−
** 713.66   
+
 
* Synonym(s):
 
* Synonym(s):
−
** N5-methyl--H4PteGlu3
+
** nitrile
−
** 5-methyltetrahydropteroyl tri-L-glutamate
+
** R-CN
 +
** a nitrile
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[HOMOCYSMET-RXN]]
+
* [[3.5.5.1-RXN]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a nitrile}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852302 49852302]
+
{{#set: common name=nitrile|R-CN|a nitrile}}
−
* CHEMSPIDER:
+
{{#set: reversible reaction associated=3.5.5.1-RXN}}
−
** [http://www.chemspider.com/Chemical-Structure.17625689.html 17625689]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58207 58207]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C04489 C04489]
+
−
* HMDB : HMDB12177
+
−
{{#set: smiles=CN1([CH](CNC2(N=C(NC(=O)C1=2)N))CNC3(=CC=C(C(=O)NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(NC(C([O-])=O)CCC(=O)[O-])=O)=O)C=C3))}}
+
−
{{#set: inchi key=InChIKey=HVRNKDVLFAVCJF-VJANTYMQSA-J}}
+
−
{{#set: common name=N5-methyl--tetrahydropteroyl tri-L-glutamate}}
+
−
{{#set: molecular weight=713.66    }}
+
−
{{#set: common name=N5-methyl--H4PteGlu3|5-methyltetrahydropteroyl tri-L-glutamate}}
+
−
{{#set: reversible reaction associated=HOMOCYSMET-RXN}}
+

Revision as of 15:43, 21 March 2018

Metabolite Nitriles

  • common name:
    • a nitrile
  • Synonym(s):
    • nitrile
    • R-CN
    • a nitrile

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5939&oldid=35897"