Difference between revisions of "Linoleoyl-groups"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * smiles: ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_9096 == * right end position: ** 4516 * transcription direction: ** POSITIVE * left end position: ** 19 * centisome position: ** 0.13492402...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_9096 == |
| − | * | + | * right end position: |
| − | ** | + | ** 4516 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 19 |
| − | * | + | * centisome position: |
| − | ** | + | ** 0.13492402 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[2.3.1.43-RXN]] |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | == | + | *** Assignment: automated-name-match |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=4516}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: left end position=19}} | |
| − | + | {{#set: centisome position=0.13492402 }} | |
| − | {{#set: | + | {{#set: reaction associated=2.3.1.43-RXN}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 15:44, 21 March 2018
Gene Tiso_gene_9096
- right end position:
- 4516
- transcription direction:
- POSITIVE
- left end position:
- 19
- centisome position:
- 0.13492402
- Synonym(s):
Reactions associated
- Reaction: 2.3.1.43-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
