Difference between revisions of "CPD-12897"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] == * smiles: ** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIS-ACONITATE HOMO-CIS-ACONITATE] == * smiles: ** C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-] * c...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIS-ACONITATE HOMO-CIS-ACONITATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** cis-homoaconitate |
+ | * inchi key: | ||
+ | ** InChIKey=BJYPZFUWWJSAKC-ARJAWSKDSA-K | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 185.113 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-carboxyhex-2-enedioate |
+ | ** (Z)-but-1-ene-1,2,4-tricarboxylate | ||
+ | ** homo-cis-aconitate | ||
+ | ** (Z)-1,2,4-but-1-enetricarboxylic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[HOMOACONITATE-HYDRATASE-RXN]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21158450 21158450] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.20117984.html 20117984] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58174 58174] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04002 C04002] |
− | + | {{#set: smiles=C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-]}} | |
− | {{#set: smiles= | + | {{#set: common name=cis-homoaconitate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=BJYPZFUWWJSAKC-ARJAWSKDSA-K}} |
− | {{#set: | + | {{#set: molecular weight=185.113 }} |
− | {{#set: molecular weight= | + | {{#set: common name=3-carboxyhex-2-enedioate|(Z)-but-1-ene-1,2,4-tricarboxylate|homo-cis-aconitate|(Z)-1,2,4-but-1-enetricarboxylic acid}} |
− | {{#set: common name= | + | {{#set: reversible reaction associated=HOMOACONITATE-HYDRATASE-RXN}} |
− | {{#set: | + |
Revision as of 15:44, 21 March 2018
Contents
Metabolite HOMO-CIS-ACONITATE
- smiles:
- C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-]
- common name:
- cis-homoaconitate
- inchi key:
- InChIKey=BJYPZFUWWJSAKC-ARJAWSKDSA-K
- molecular weight:
- 185.113
- Synonym(s):
- 3-carboxyhex-2-enedioate
- (Z)-but-1-ene-1,2,4-tricarboxylate
- homo-cis-aconitate
- (Z)-1,2,4-but-1-enetricarboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-" cannot be used as a page name in this wiki.