Difference between revisions of "THZ-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * inchi key: ** InChIKey=OCYMERZC...") |
(Created page with "Category:Gene == Gene Tiso_gene_20270 == * right end position: ** 1561 * transcription direction: ** POSITIVE * left end position: ** 252 * centisome position: ** 15.86901...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_20270 == |
| − | * | + | * right end position: |
| − | ** | + | ** 1561 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 252 |
| − | * | + | * centisome position: |
| − | ** | + | ** 15.869017 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[2.7.11.2-RXN]] |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | * [[ | + | *** Assignment: automated-name-match |
| − | == | + | == Pathways associated == |
== External links == | == External links == | ||
| − | + | {{#set: right end position=1561}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: left end position=252}} | |
| − | + | {{#set: centisome position=15.869017 }} | |
| − | + | {{#set: reaction associated=2.7.11.2-RXN}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 15:44, 21 March 2018
Gene Tiso_gene_20270
- right end position:
- 1561
- transcription direction:
- POSITIVE
- left end position:
- 252
- centisome position:
- 15.869017
- Synonym(s):
Reactions associated
- Reaction: 2.7.11.2-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
