Difference between revisions of "2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6P FRUCTOSE-6P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CO)(O)C(O)C(O)1) * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGIBh PGIBh] == * direction: ** REVERSIBLE * common name: ** glucose-6-phosphate isomerase, chlorop...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGIBh PGIBh] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** glucose-6-phosphate isomerase, chloroplast (g6p-B) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[GLC-6-P]][h] '''<=>''' 1.0 [[FRUCTOSE-6P]][h] |
− | + | * With common name(s): | |
− | = | + | ** 1.0 β-D-glucose 6-phosphate[h] '''<=>''' 1.0 β-D-fructofuranose 6-phosphate[h] |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | * | + | Genes have been associated with this reaction based on different elements listed below. |
− | + | * Gene: [[Tiso_gene_19480]] | |
− | * | + | ** Source: [[orthology-creinhardtii]] |
− | + | == Pathways == | |
− | + | == Reconstruction information == | |
− | + | * Category: [[orthology]] | |
− | + | ** Source: [[orthology-creinhardtii]] | |
− | * [[ | + | *** Tool: [[pantograph]] |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=glucose-6-phosphate isomerase, chloroplast (g6p-B)}} | |
− | + | {{#set: gene associated=Tiso_gene_19480}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:45, 21 March 2018
Contents
Reaction PGIBh
- direction:
- REVERSIBLE
- common name:
- glucose-6-phosphate isomerase, chloroplast (g6p-B)
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 GLC-6-P[h] <=> 1.0 FRUCTOSE-6P[h]
- With common name(s):
- 1.0 β-D-glucose 6-phosphate[h] <=> 1.0 β-D-fructofuranose 6-phosphate[h]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_19480
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii