Difference between revisions of "CPD-356"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * smiles: ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11480 RXN-11480] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-(acyl-carrier-pro...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11480 RXN-11480] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-oxoacyl-(acyl-carrier-protein) |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[3-Ketopimeloyl-ACP-methyl-esters]][c] '''=>''' 1 [[3-hydroxypimeloyl-ACP-methyl-esters]][c] '''+''' 1 [[NADP]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a 3-oxo-pimeloyl-[acp] methyl ester[c] '''=>''' 1 a (3R)-3-hydroxypimeloyl-[acp] methyl ester[c] '''+''' 1 NADP+[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_13083]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_9885]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519] | ||
+ | ** '''9''' reactions found over '''11''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=3-oxoacyl-(acyl-carrier-protein)}} | |
− | + | {{#set: ec number=EC-1.1.1.100}} | |
− | + | {{#set: gene associated=Tiso_gene_13083|Tiso_gene_9885}} | |
− | + | {{#set: in pathway=PWY-6519}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:45, 21 March 2018
Contents
Reaction RXN-11480
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-oxoacyl-(acyl-carrier-protein)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 NADPH[c] + 1 3-Ketopimeloyl-ACP-methyl-esters[c] => 1 3-hydroxypimeloyl-ACP-methyl-esters[c] + 1 NADP[c]
- With common name(s):
- 1 H+[c] + 1 NADPH[c] + 1 a 3-oxo-pimeloyl-[acp] methyl ester[c] => 1 a (3R)-3-hydroxypimeloyl-[acp] methyl ester[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13083
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_9885
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
Pathways
- PWY-6519, 8-amino-7-oxononanoate biosynthesis I: PWY-6519
- 9 reactions found over 11 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation