Difference between revisions of "CPD-356"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * smiles: ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O * inchi...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11480 RXN-11480] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-(acyl-carrier-pro...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11480 RXN-11480] ==
* smiles:
+
* direction:
** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K
+
 
* common name:
 
* common name:
** oxalosuccinate
+
** 3-oxoacyl-(acyl-carrier-protein)
* molecular weight:
+
* ec number:
** 187.085   
+
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
 
* Synonym(s):
 
* Synonym(s):
** oxalo-succ
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[3-Ketopimeloyl-ACP-methyl-esters]][c] '''=>''' 1 [[3-hydroxypimeloyl-ACP-methyl-esters]][c] '''+''' 1 [[NADP]][c]
* [[RXN-8642]]
+
* With common name(s):
* [[RXN-9951]]
+
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a 3-oxo-pimeloyl-[acp] methyl ester[c] '''=>''' 1 a (3R)-3-hydroxypimeloyl-[acp] methyl ester[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13083]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_9885]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
 +
** '''9''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C05379 C05379]
+
{{#set: common name=3-oxoacyl-(acyl-carrier-protein)}}
* CHEBI:
+
{{#set: ec number=EC-1.1.1.100}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58931 58931]
+
{{#set: gene associated=Tiso_gene_13083|Tiso_gene_9885}}
* METABOLIGHTS : MTBLC58931
+
{{#set: in pathway=PWY-6519}}
* PUBCHEM:
+
{{#set: reconstruction category=orthology|annotation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244267 25244267]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
* HMDB : HMDB03974
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: smiles=C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O}}
+
{{#set: inchi key=InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K}}
+
{{#set: common name=oxalosuccinate}}
+
{{#set: molecular weight=187.085    }}
+
{{#set: common name=oxalo-succ}}
+
{{#set: reversible reaction associated=RXN-8642|RXN-9951}}
+

Revision as of 15:45, 21 March 2018

Reaction RXN-11480

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxoacyl-(acyl-carrier-protein)
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6519, 8-amino-7-oxononanoate biosynthesis I: PWY-6519
    • 9 reactions found over 11 reactions in the full pathway

Reconstruction information

External links