Difference between revisions of "MELIBIOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_3065 == * right end position: ** 7036 * transcription direction: ** POSITIVE * left end position: ** 3122 * centisome position: ** 17.73561...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3065 == |
− | * | + | * right end position: |
− | ** | + | ** 7036 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3122 |
− | * | + | * centisome position: |
− | ** | + | ** 17.735615 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-11856]] |
− | * | + | ** Source: [[annotation-experimental_annotation]] |
− | + | *** Assignment: ec-number | |
− | * [[ | + | == Pathways associated == |
− | * | + | * [[PWY-6829]] |
− | * | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=7036}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3122}} | |
− | + | {{#set: centisome position=17.735615 }} | |
− | + | {{#set: reaction associated=RXN-11856}} | |
− | + | {{#set: pathway associated=PWY-6829}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 15:45, 21 March 2018
Gene Tiso_gene_3065
- right end position:
- 7036
- transcription direction:
- POSITIVE
- left end position:
- 3122
- centisome position:
- 17.735615
- Synonym(s):
Reactions associated
- Reaction: RXN-11856
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation