Difference between revisions of "S-ubiquitinyl-E3-independent-E2-Cys"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == * smiles: ** C(OP([O-])(=O)[O-])C([O-])=O * inchi key: ** InChIKey=ASCFNMCAHF...") |
(Created page with "Category:Gene == Gene Tiso_gene_2848 == * Synonym(s): == Reactions associated == * Reaction: GGPS ** Source: orthology-creinhardtii * Reaction: GPPS ** Source...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2848 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GGPS]] |
− | + | ** Source: [[orthology-creinhardtii]] | |
− | == | + | * Reaction: [[GPPS]] |
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[GPPSYN-RXN]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[RXN-11486]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-9003]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-9384]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN0-5180]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7736]] | ||
+ | * [[PWY-6859]] | ||
+ | * [[PWY-7709]] | ||
+ | * [[PWY-7102]] | ||
+ | * [[PWY-7235]] | ||
+ | * [[PWY-7182]] | ||
+ | * [[PWY-7141]] | ||
+ | * [[PWY-5123]] | ||
+ | * [[PWY-5122]] | ||
+ | * [[PWY-6520]] | ||
+ | * [[PWY-6383]] | ||
+ | * [[PWY-7659]] | ||
+ | * [[PWY-5805]] | ||
+ | * [[PWY-7410]] | ||
+ | * [[PWY3O-19]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=GGPS|GPPS|GPPSYN-RXN|RXN-11486|RXN-9003|RXN-9384|RXN0-5180|TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7736|PWY-6859|PWY-7709|PWY-7102|PWY-7235|PWY-7182|PWY-7141|PWY-5123|PWY-5122|PWY-6520|PWY-6383|PWY-7659|PWY-5805|PWY-7410|PWY3O-19}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 15:46, 21 March 2018
Gene Tiso_gene_2848
- Synonym(s):
Reactions associated
- Reaction: GGPS
- Source: orthology-creinhardtii
- Reaction: GPPS
- Source: orthology-creinhardtii
- Reaction: GPPSYN-RXN
- Source: orthology-creinhardtii
- Reaction: RXN-11486
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Reaction: RXN-9003
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Reaction: RXN-9384
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Reaction: RXN0-5180
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Reaction: TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
Pathways associated
- PWY-7736
- PWY-6859
- PWY-7709
- PWY-7102
- PWY-7235
- PWY-7182
- PWY-7141
- PWY-5123
- PWY-5122
- PWY-6520
- PWY-6383
- PWY-7659
- PWY-5805
- PWY-7410
- PWY3O-19