Difference between revisions of "Tiso gene 2991"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH33ADO CH33ADO] == * smiles: ** CC1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene Tiso_gene_9366 == * right end position: ** 4084 * transcription direction: ** POSITIVE * left end position: ** 2726 * centisome position: ** 28.99383...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9366 == |
− | * | + | * right end position: |
− | ** | + | ** 4084 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2726 |
− | * | + | * centisome position: |
− | ** | + | ** 28.99383 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.5.1.9-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
− | + | * [[LYSINE-DEG1-PWY]] | |
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4084}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=2726}} | |
− | + | {{#set: centisome position=28.99383 }} | |
− | + | {{#set: reaction associated=1.5.1.9-RXN}} | |
− | + | {{#set: pathway associated=LYSINE-DEG1-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:46, 21 March 2018
Gene Tiso_gene_9366
- right end position:
- 4084
- transcription direction:
- POSITIVE
- left end position:
- 2726
- centisome position:
- 28.99383
- Synonym(s):
Reactions associated
- Reaction: 1.5.1.9-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation