Difference between revisions of "DNA-N"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])O * inchi key: ** InChIKey=JUCRENB...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Galactopyranose L-Galactopyranose] == * common name: ** L-galactopyranose * Synonym(s): == R...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Galactopyranose L-Galactopyranose] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** L-galactopyranose |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-1884]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXNQT-4142]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=L-galactopyranose}} | |
− | + | {{#set: consumed by=RXN-1884}} | |
− | + | {{#set: produced by=RXNQT-4142}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: consumed by=RXN- | + | |
− | {{#set: | + |
Revision as of 15:47, 21 March 2018
Contents
Metabolite L-Galactopyranose
- common name:
- L-galactopyranose
- Synonym(s):