Difference between revisions of "Tiso gene 11758"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == * smiles: ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Heparan-NAc-Glc Heparan-NAc-Glc] == * common name: ** a [heparan]-N-acetyl-α-D-glucosamin...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Heparan-NAc-Glc Heparan-NAc-Glc] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a [heparan]-N-acetyl-α-D-glucosamine |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a heparin glucosamine |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.1.6.14-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a [heparan]-N-acetyl-α-D-glucosamine}} | |
− | + | {{#set: common name=a heparin glucosamine}} | |
− | + | {{#set: produced by=3.1.6.14-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 15:47, 21 March 2018
Contents
Metabolite Heparan-NAc-Glc
- common name:
- a [heparan]-N-acetyl-α-D-glucosamine
- Synonym(s):
- a heparin glucosamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [heparan]-N-acetyl-α-D-glucosamine" cannot be used as a page name in this wiki.