Difference between revisions of "FADH2"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL-2-DEHYDROGENASE-RXN MYO-INOSITOL-2-DEHYDROGENASE-RXN] == * direction: ** REVERSIBLE *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * common name: ** monodehydroa...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) |
− | * | + | * common name: |
− | ** | + | ** monodehydroascorbate radical |
+ | * inchi key: | ||
+ | ** InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N | ||
+ | * molecular weight: | ||
+ | ** 175.118 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** monodehydroascorbic acid | ||
+ | ** semidehydroascorbic acid | ||
+ | ** semidehydroascorbate | ||
+ | ** ascorbyl radical | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-3523]] |
− | + | * [[1.6.5.4-RXN]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10981]] | |
− | + | * [[RXN-3521]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5483640 5483640] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16504 16504] |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01041 C01041] |
− | {{#set: | + | {{#set: smiles=C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)}} |
− | {{#set: | + | {{#set: common name=monodehydroascorbate radical}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N}} |
− | {{#set: | + | {{#set: molecular weight=175.118 }} |
− | {{#set: | + | {{#set: common name=monodehydroascorbic acid|semidehydroascorbic acid|semidehydroascorbate|ascorbyl radical}} |
− | {{#set: | + | {{#set: consumed by=RXN-3523|1.6.5.4-RXN}} |
− | {{#set: | + | {{#set: produced by=RXN-10981|RXN-3521}} |
Revision as of 15:47, 21 March 2018
Contents
Metabolite CPD-318
- smiles:
- C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
- common name:
- monodehydroascorbate radical
- inchi key:
- InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
- molecular weight:
- 175.118
- Synonym(s):
- monodehydroascorbic acid
- semidehydroascorbic acid
- semidehydroascorbate
- ascorbyl radical
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)" cannot be used as a page name in this wiki.