Difference between revisions of "FADH2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL-2-DEHYDROGENASE-RXN MYO-INOSITOL-2-DEHYDROGENASE-RXN] == * direction: ** REVERSIBLE *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * common name: ** monodehydroa...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL-2-DEHYDROGENASE-RXN MYO-INOSITOL-2-DEHYDROGENASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.1.1.18 EC-1.1.1.18]
+
** monodehydroascorbate radical
 +
* inchi key:
 +
** InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
 +
* molecular weight:
 +
** 175.118   
 
* Synonym(s):
 
* Synonym(s):
 +
** monodehydroascorbic acid
 +
** semidehydroascorbic acid
 +
** semidehydroascorbate
 +
** ascorbyl radical
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-3523]]
−
** 1 [[NAD]][c] '''+''' 1 [[MYO-INOSITOL]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[CPD-14808]][c]
+
* [[1.6.5.4-RXN]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 NAD+[c] '''+''' 1 myo-inositol[c] '''<=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 scyllo-inosose[c]
+
* [[RXN-10981]]
−
 
+
* [[RXN-3521]]
−
== Genes associated with this reaction  ==
+
== Reaction(s) of unknown directionality ==
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_17306]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[P562-PWY]], myo-inositol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=P562-PWY P562-PWY]
+
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7241]], myo-inositol degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7241 PWY-7241]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7237]], myo-, chiro- and scillo-inositol degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7237 PWY-7237]
+
−
** '''2''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-5940]], streptomycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5940 PWY-5940]
+
−
** '''2''' reactions found over '''18''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16949 16949]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5483640 5483640]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01183 R01183]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16504 16504]
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P26935 P26935]
+
** [http://www.genome.jp/dbget-bin/www_bget?C01041 C01041]
−
{{#set: direction=REVERSIBLE}}
+
{{#set: smiles=C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)}}
−
{{#set: ec number=EC-1.1.1.18}}
+
{{#set: common name=monodehydroascorbate radical}}
−
{{#set: gene associated=Tiso_gene_17306}}
+
{{#set: inchi key=InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N}}
−
{{#set: in pathway=P562-PWY|PWY-7241|PWY-7237|PWY-5940}}
+
{{#set: molecular weight=175.118    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=monodehydroascorbic acid|semidehydroascorbic acid|semidehydroascorbate|ascorbyl radical}}
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
{{#set: consumed by=RXN-3523|1.6.5.4-RXN}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-10981|RXN-3521}}

Revision as of 15:47, 21 March 2018

Metabolite CPD-318

  • smiles:
    • C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
  • common name:
    • monodehydroascorbate radical
  • inchi key:
    • InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
  • molecular weight:
    • 175.118
  • Synonym(s):
    • monodehydroascorbic acid
    • semidehydroascorbic acid
    • semidehydroascorbate
    • ascorbyl radical

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=FADH2&oldid=36307"