Difference between revisions of "CPD-13910"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == * smiles: ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14264 RXN-14264] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14264 RXN-14264] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.3.8.4 EC-1.3.8.4] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[ISOVALERYL-COA]][c] '''+''' 1 [[FAD]][c] '''+''' 1 [[PROTON]][c] '''<=>''' 1 [[3-METHYL-CROTONYL-COA]][c] '''+''' 1 [[FADH2]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 isovaleryl-CoA[c] '''+''' 1 FAD[c] '''+''' 1 H+[c] '''<=>''' 1 3-methylcrotonyl-CoA[c] '''+''' 1 FADH2[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_8272]] | ||
| + | ** Source: [[orthology-athaliana]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_14511]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_18542]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_6475]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_10643]] | ||
| + | ** Source: [[orthology-athaliana]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-athaliana]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31064 31064] |
| − | {{#set: | + | * LIGAND-RXN: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04095 R04095] |
| − | {{#set: | + | {{#set: direction=REVERSIBLE}} |
| − | {{#set: | + | {{#set: ec number=EC-1.3.8.4}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_8272|Tiso_gene_14511|Tiso_gene_18542|Tiso_gene_6475|Tiso_gene_10643}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| + | {{#set: reconstruction category=orthology}} | ||
| + | {{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}} | ||
| + | {{#set: reconstruction tool=pantograph}} | ||
Revision as of 15:47, 21 March 2018
Contents
Reaction RXN-14264
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ISOVALERYL-COA[c] + 1 FAD[c] + 1 PROTON[c] <=> 1 3-METHYL-CROTONYL-COA[c] + 1 FADH2[c]
- With common name(s):
- 1 isovaleryl-CoA[c] + 1 FAD[c] + 1 H+[c] <=> 1 3-methylcrotonyl-CoA[c] + 1 FADH2[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_8272
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Gene: Tiso_gene_14511
- Source: orthology-esiliculosus
- Gene: Tiso_gene_18542
- Source: orthology-esiliculosus
- Gene: Tiso_gene_6475
- Source: orthology-esiliculosus
- Gene: Tiso_gene_10643
- Source: orthology-athaliana
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
External links
