Difference between revisions of "GLUTAMATE-SYNTHASE-NADH-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == * smiles: ** C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(...")
(Created page with "Category:Gene == Gene Tiso_gene_10265 == * right end position: ** 3515 * transcription direction: ** POSITIVE * left end position: ** 370 * centisome position: ** 4.262673...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] ==
+
== Gene Tiso_gene_10265 ==
* smiles:
+
* right end position:
** C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** 3515
* inchi key:
+
* transcription direction:
** InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
+
** POSITIVE
* common name:
+
* left end position:
** pppGpp
+
** 370
* molecular weight:
+
* centisome position:
** 677.095    
+
** 4.262673    
 
* Synonym(s):
 
* Synonym(s):
** guanosine pentaphosphate
 
** guanosine 3'-diphosphate 5'-triphosphate
 
** guanosine 5'-triphosphate,3'-diphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN0-6427]]
+
* Reaction: [[3.2.1.14-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[GTPPYPHOSKIN-RXN]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7822]]
 +
* [[PWY-6902]]
 +
* [[PWY-6855]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: right end position=3515}}
** [http://www.genome.jp/dbget-bin/www_bget?C04494 C04494]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=370}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16690 16690]
+
{{#set: centisome position=4.262673   }}
* BIGG : gdptp
+
{{#set: reaction associated=3.2.1.14-RXN}}
* PUBCHEM:
+
{{#set: pathway associated=PWY-7822|PWY-6902|PWY-6855}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173549 46173549]
+
* HMDB : HMDB60480
+
{{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: inchi key=InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H}}
+
{{#set: common name=pppGpp}}
+
{{#set: molecular weight=677.095   }}
+
{{#set: common name=guanosine pentaphosphate|guanosine 3'-diphosphate 5'-triphosphate|guanosine 5'-triphosphate,3'-diphosphate}}
+
{{#set: consumed by=RXN0-6427}}
+
{{#set: produced by=GTPPYPHOSKIN-RXN}}
+

Revision as of 15:48, 21 March 2018

Gene Tiso_gene_10265

  • right end position:
    • 3515
  • transcription direction:
    • POSITIVE
  • left end position:
    • 370
  • centisome position:
    • 4.262673
  • Synonym(s):

Reactions associated

Pathways associated

External links