Difference between revisions of "RXN-9952"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6541 == * Synonym(s): == Reactions associated == * 2.7.8.11-RXN ** pantograph-esiliculosus == Pathways associated == * PWY-6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7682 CPD-7682] == * smiles: ** C(C1(CCCC=N1))([O-])=O * common name: ** (S)-2,3,4,5-tetrahy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7682 CPD-7682] == |
+ | * smiles: | ||
+ | ** C(C1(CCCC=N1))([O-])=O | ||
+ | * common name: | ||
+ | ** (S)-2,3,4,5-tetrahydropiperidine-2-carboxylate | ||
+ | * inchi key: | ||
+ | ** InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M | ||
+ | * molecular weight: | ||
+ | ** 126.135 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Δ1-piperideine-6-carboxylate | ||
+ | ** Δ6-piperideine-2-carboxylate | ||
+ | ** 1,6-didehydropiperidine-2-carboxylate | ||
+ | ** 2,3,4,5-tetrahydropyridine-2-carboxylate | ||
+ | ** 1-piperideine 6-carboxylate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-8162]] |
− | + | * [[RXN-10855]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | * [[RXN-8173]] |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00450 C00450] |
+ | * HMDB : HMDB59657 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58769 58769] | ||
+ | * METABOLIGHTS : MTBLC58769 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266761 45266761] | ||
+ | {{#set: smiles=C(C1(CCCC=N1))([O-])=O}} | ||
+ | {{#set: common name=(S)-2,3,4,5-tetrahydropiperidine-2-carboxylate}} | ||
+ | {{#set: inchi key=InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M}} | ||
+ | {{#set: molecular weight=126.135 }} | ||
+ | {{#set: common name=Δ1-piperideine-6-carboxylate|Δ6-piperideine-2-carboxylate|1,6-didehydropiperidine-2-carboxylate|2,3,4,5-tetrahydropyridine-2-carboxylate|1-piperideine 6-carboxylate}} | ||
+ | {{#set: consumed by=RXN-8162|RXN-10855}} | ||
+ | {{#set: reversible reaction associated=RXN-8173}} |
Revision as of 15:49, 21 March 2018
Contents
Metabolite CPD-7682
- smiles:
- C(C1(CCCC=N1))([O-])=O
- common name:
- (S)-2,3,4,5-tetrahydropiperidine-2-carboxylate
- inchi key:
- InChIKey=CSDPVAKVEWETFG-YFKPBYRVSA-M
- molecular weight:
- 126.135
- Synonym(s):
- Δ1-piperideine-6-carboxylate
- Δ6-piperideine-2-carboxylate
- 1,6-didehydropiperidine-2-carboxylate
- 2,3,4,5-tetrahydropyridine-2-carboxylate
- 1-piperideine 6-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(CCCC=N1))([O-])=O" cannot be used as a page name in this wiki.