Difference between revisions of "N-Ac-L-methionyl-L-glutamyl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11486 RXN-11486] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] == * smiles: ** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11486 RXN-11486] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.5.1.85 EC-2.5.1.85]
+
** L-threonylcarbamoyladenylate
 +
* inchi key:
 +
** InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
 +
* molecular weight:
 +
** 490.322   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14570]]
−
** 5 [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[GERANYLGERANYL-PP]][c] '''=>''' 1 [[SOLANESYL-PYROPHOSPHATE]][c] '''+''' 5 [[PPI]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 5 isopentenyl diphosphate[c] '''+''' 1 geranylgeranyl diphosphate[c] '''=>''' 1 all-trans-nonaprenyl diphosphate[c] '''+''' 5 diphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_2848]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_18201]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
== Pathways  ==
+
−
* [[PWY-6520]], nonaprenyl diphosphate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6520 PWY-6520]
+
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-synechocystis]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27594 27594]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464565 71464565]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R09251 R09251]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73682 73682]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O}}
−
{{#set: ec number=EC-2.5.1.85}}
+
{{#set: common name=L-threonylcarbamoyladenylate}}
−
{{#set: gene associated=Tiso_gene_2848|Tiso_gene_18201}}
+
{{#set: inchi key=InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L}}
−
{{#set: in pathway=PWY-6520}}
+
{{#set: molecular weight=490.322    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: consumed by=RXN-14570}}
−
{{#set: reconstruction source=orthology-synechocystis|orthology-esiliculosus}}
+
−
{{#set: reconstruction tool=pantograph}}
+

Revision as of 15:49, 21 March 2018

Metabolite CPD-15435

  • smiles:
    • CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
  • common name:
    • L-threonylcarbamoyladenylate
  • inchi key:
    • InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
  • molecular weight:
    • 490.322
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-Ac-L-methionyl-L-glutamyl-Protein&oldid=36518"