Difference between revisions of "Tiso gene 1855"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14278 == * left end position: ** 153 * transcription direction: ** POSITIVE * right end position: ** 4477 * centisome position: ** 2.664576...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * common name: |
| − | ** | + | ** isofucosterol |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 412.698 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-4210]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281326 5281326] |
| − | {{#set: | + | * HMDB : HMDB02374 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821] |
| − | {{#set: | + | {{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
| + | {{#set: common name=isofucosterol}} | ||
| + | {{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}} | ||
| + | {{#set: molecular weight=412.698 }} | ||
| + | {{#set: produced by=RXN-4210}} | ||
Revision as of 15:50, 21 March 2018
Contents
Metabolite CPD-4127
- smiles:
- CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- isofucosterol
- inchi key:
- InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
- molecular weight:
- 412.698
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
