Difference between revisions of "DNA-6-O-Methyl-Guanines"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NITRATE NITRATE] == * smiles: ** N(=O)(=O)[O-] * inchi key: ** InChIKey=NHNBFGGVMKEFGY-UHFFFAOY...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] == |
* smiles: | * smiles: | ||
− | ** | + | ** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** XLXG xyloglucan oligosaccharide |
+ | * inchi key: | ||
+ | ** InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1225.073 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12399]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940192 52940192] |
− | + | {{#set: smiles=C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}} | |
− | + | {{#set: common name=XLXG xyloglucan oligosaccharide}} | |
− | + | {{#set: inchi key=InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N}} | |
− | + | {{#set: molecular weight=1225.073 }} | |
− | + | {{#set: consumed by=RXN-12399}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: smiles= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: molecular weight= | + | |
− | + | ||
− | {{#set: consumed by= | + | |
− | + | ||
− | + |
Revision as of 15:50, 21 March 2018
Contents
Metabolite CPD-13377
- smiles:
- C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
- common name:
- XLXG xyloglucan oligosaccharide
- inchi key:
- InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N
- molecular weight:
- 1225.073
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: