Difference between revisions of "Sialyloligosaccharides"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])=O * inchi key: ** InChIKey=OUGL...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDDHm ALDDHm] == * direction: ** LEFT-TO-RIGHT * common name: ** aldehyde dehydrogenase (acetaldeh...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDDHm ALDDHm] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** aldehyde dehydrogenase (acetaldehyde, NAD), mitochondrial |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1.0 [[NAD]][m] '''+''' 1.0 [[ACETALD]][m] '''+''' 1.0 [[WATER]][m] '''=>''' 1.0 [[ACET]][m] '''+''' 2.0 [[PROTON]][m] '''+''' 1.0 [[NADH]][m] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1.0 NAD+[m] '''+''' 1.0 acetaldehyde[m] '''+''' 1.0 H2O[m] '''=>''' 1.0 acetate[m] '''+''' 2.0 H+[m] '''+''' 1.0 NADH[m] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_3513]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: common name=aldehyde dehydrogenase (acetaldehyde, NAD), mitochondrial}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_3513}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-creinhardtii}} |
| + | {{#set: reconstruction tool=pantograph}} | ||
Revision as of 16:51, 21 March 2018
Contents
Reaction ALDDHm
- direction:
- LEFT-TO-RIGHT
- common name:
- aldehyde dehydrogenase (acetaldehyde, NAD), mitochondrial
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 NAD+[m] + 1.0 acetaldehyde[m] + 1.0 H2O[m] => 1.0 acetate[m] + 2.0 H+[m] + 1.0 NADH[m]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3513
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
