Difference between revisions of "RXN66-483"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == * smiles: ** C(=O)([O-])C1(C=CC(=CC=1)N) * inchi key: **...")
(Created page with "Category:Gene == Gene Tiso_gene_7387 == * right end position: ** 9600 * transcription direction: ** POSITIVE * left end position: ** 6776 * centisome position: ** 60.33300...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] ==
+
== Gene Tiso_gene_7387 ==
−
* smiles:
+
* right end position:
−
** C(=O)([O-])C1(C=CC(=CC=1)N)
+
** 9600
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 4-aminobenzoate
+
** 6776
−
* molecular weight:
+
* centisome position:
−
** 136.13    
+
** 60.333008    
 
* Synonym(s):
 
* Synonym(s):
−
** para-aminobenzoic acid
 
−
** p-aminobenzoic acid
 
−
** para-aminobenzoate
 
−
** p-aminobenzoate
 
−
** 4-aminobenzoic acid
 
−
** pABA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[H2PTEROATESYNTH-RXN]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[ADCLY-RXN]]
+
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
−
* [[RXN-14226]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* CAS : 150-13-0
+
{{#set: right end position=9600}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4876 4876]
+
{{#set: left end position=6776}}
−
* HMDB : HMDB01392
+
{{#set: centisome position=60.333008   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00568 C00568]
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4710.html 4710]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17836 17836]
+
−
* BIGG : 4abz
+
−
{{#set: smiles=C(=O)([O-])C1(C=CC(=CC=1)N)}}
+
−
{{#set: inchi key=InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M}}
+
−
{{#set: common name=4-aminobenzoate}}
+
−
{{#set: molecular weight=136.13   }}
+
−
{{#set: common name=para-aminobenzoic acid|p-aminobenzoic acid|para-aminobenzoate|p-aminobenzoate|4-aminobenzoic acid|pABA}}
+
−
{{#set: consumed by=H2PTEROATESYNTH-RXN}}
+
−
{{#set: reversible reaction associated=ADCLY-RXN|RXN-14226}}
+

Revision as of 15:51, 21 March 2018

Gene Tiso_gene_7387

  • right end position:
    • 9600
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6776
  • centisome position:
    • 60.333008
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN66-483&oldid=36790"