Difference between revisions of "Tiso gene 6871"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LNLCCOAL LNLCCOAL] == * direction: ** LEFT-TO-RIGHT * common name: ** Linoleic acid:CoA ligase (AMP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11529 CPD-11529] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11529 CPD-11529] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4) |
* common name: | * common name: | ||
| − | ** | + | ** jasmonoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=WQKKCPPNDKSAIU-PCDAEQFSSA-J | ||
| + | * molecular weight: | ||
| + | ** 955.76 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-10708]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10701]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237154 44237154] |
| − | {{#set: | + | {{#set: smiles=CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}} |
| − | {{#set: | + | {{#set: common name=jasmonoyl-CoA}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=WQKKCPPNDKSAIU-PCDAEQFSSA-J}} |
| − | {{#set: | + | {{#set: molecular weight=955.76 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-10708}} |
| + | {{#set: produced by=RXN-10701}} | ||
Revision as of 15:51, 21 March 2018
Contents
Metabolite CPD-11529
- smiles:
- CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
- common name:
- jasmonoyl-CoA
- inchi key:
- InChIKey=WQKKCPPNDKSAIU-PCDAEQFSSA-J
- molecular weight:
- 955.76
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.
