Difference between revisions of "Peptides-with-Leader-Sequence"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Gene == Gene Tiso_gene_15858 == * right end position: ** 6979 * transcription direction: ** NEGATIVE * left end position: ** 5781 * centisome position: ** 74.4398...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] ==
+
== Gene Tiso_gene_15858 ==
* smiles:
+
* right end position:
** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 6979
* inchi key:
+
* transcription direction:
** InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
+
** NEGATIVE
* common name:
+
* left end position:
** (7Z)-hexadecenoyl-CoA
+
** 5781
* molecular weight:
+
* centisome position:
** 999.899    
+
** 74.439865    
 
* Synonym(s):
 
* Synonym(s):
** cis-hexadec-7-enoyl-CoA
 
** (7Z)-hexadec-7-enoyl-CoA
 
** 16:1 cis-7
 
** 16:1(n-9)
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17779]]
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-17778]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=6979}}
{{#set: inchi key=InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
{{#set: common name=(7Z)-hexadecenoyl-CoA}}
+
{{#set: left end position=5781}}
{{#set: molecular weight=999.899   }}
+
{{#set: centisome position=74.439865   }}
{{#set: common name=cis-hexadec-7-enoyl-CoA|(7Z)-hexadec-7-enoyl-CoA|16:1 cis-7|16:1(n-9)}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
{{#set: consumed by=RXN-17779}}
+
{{#set: produced by=RXN-17778}}
+

Revision as of 15:51, 21 March 2018

Gene Tiso_gene_15858

  • right end position:
    • 6979
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 5781
  • centisome position:
    • 74.439865
  • Synonym(s):

Reactions associated

Pathways associated

External links