Difference between revisions of "Tiso gene 16560"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Apo-EntB Apo-EntB] == * common name: ** an apo-[EntB isochorismatase/aryl-carrier protein] * Sy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9646 CPD-9646] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9646 CPD-9646] == |
| + | * smiles: | ||
| + | ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C | ||
* common name: | * common name: | ||
| − | ** | + | ** di-trans,octa-cis-undecaprenyl phosphate |
| + | * inchi key: | ||
| + | ** InChIKey=UFPHFKCTOZIAFY-NTDVEAECSA-L | ||
| + | * molecular weight: | ||
| + | ** 845.279 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** ditrans,polycis-undecaprenyl phosphate | ||
| + | ** ditrans,octacis-undecaprenyl phosphate | ||
| + | ** C55-P | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11347]] |
| + | * [[PHOSNACMURPENTATRANS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-8975]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: consumed by= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C17556 C17556] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60392 60392] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245635 25245635] | ||
| + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C}} | ||
| + | {{#set: common name=di-trans,octa-cis-undecaprenyl phosphate}} | ||
| + | {{#set: inchi key=InChIKey=UFPHFKCTOZIAFY-NTDVEAECSA-L}} | ||
| + | {{#set: molecular weight=845.279 }} | ||
| + | {{#set: common name=ditrans,polycis-undecaprenyl phosphate|ditrans,octacis-undecaprenyl phosphate|C55-P}} | ||
| + | {{#set: consumed by=RXN-11347|PHOSNACMURPENTATRANS-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-8975}} | ||
Revision as of 15:51, 21 March 2018
Contents
Metabolite CPD-9646
- smiles:
- CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C
- common name:
- di-trans,octa-cis-undecaprenyl phosphate
- inchi key:
- InChIKey=UFPHFKCTOZIAFY-NTDVEAECSA-L
- molecular weight:
- 845.279
- Synonym(s):
- ditrans,polycis-undecaprenyl phosphate
- ditrans,octacis-undecaprenyl phosphate
- C55-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C" cannot be used as a page name in this wiki.
