Difference between revisions of "Tiso gene 19914"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] == * smiles: ** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3617 CPD-3617] == * smiles: ** CCCCCCCCCC(=O)[O-] * common name: ** decanoate * inchi key:...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3617 CPD-3617] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCCCCC(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** decanoate |
+ | * inchi key: | ||
+ | ** InChIKey=GHVNFZFCNZKVNT-UHFFFAOYSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 171.259 |
* Synonym(s): | * Synonym(s): | ||
+ | ** caprate | ||
+ | ** decanoic acid | ||
+ | ** n-decanoate | ||
+ | ** n-capric acid | ||
+ | ** caprinic acid | ||
+ | ** caprinate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13614]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CAS : 334-48-5 | ||
+ | * BIGG : dca | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4678093 4678093] |
− | {{#set: smiles= | + | * HMDB : HMDB00511 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01571 C01571] |
− | {{#set: molecular weight= | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.3866366.html 3866366] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27689 27689] | ||
+ | * METABOLIGHTS : MTBLC27689 | ||
+ | {{#set: smiles=CCCCCCCCCC(=O)[O-]}} | ||
+ | {{#set: common name=decanoate}} | ||
+ | {{#set: inchi key=InChIKey=GHVNFZFCNZKVNT-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=171.259 }} | ||
+ | {{#set: common name=caprate|decanoic acid|n-decanoate|n-capric acid|caprinic acid|caprinate}} | ||
+ | {{#set: consumed by=RXN-13614}} |
Revision as of 15:51, 21 March 2018
Contents
Metabolite CPD-3617
- smiles:
- CCCCCCCCCC(=O)[O-]
- common name:
- decanoate
- inchi key:
- InChIKey=GHVNFZFCNZKVNT-UHFFFAOYSA-M
- molecular weight:
- 171.259
- Synonym(s):
- caprate
- decanoic acid
- n-decanoate
- n-capric acid
- caprinic acid
- caprinate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 334-48-5
- BIGG : dca
- PUBCHEM:
- HMDB : HMDB00511
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC27689
"CCCCCCCCCC(=O)[O-" cannot be used as a page name in this wiki.