Difference between revisions of "RXN-1126"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-BETA-ASPARTYL-P L-BETA-ASPARTYL-P] == * smiles: ** C(C([N+])C(=O)[O-])C(=O)OP([O-])(=O)[O-] *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1126 RXN-1126] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/6....") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1126 RXN-1126] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/6.2.1.12 EC-6.2.1.12] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[ATP]][c] '''+''' 1 [[CPD-676]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[CAFFEOYL-COA]][c] '''+''' 1 [[PPI]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 ATP[c] '''+''' 1 trans-caffeate[c] '''+''' 1 coenzyme A[c] '''=>''' 1 AMP[c] '''+''' 1 trans-caffeoyl-CoA[c] '''+''' 1 diphosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14183]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_12275]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7398]], coumarins biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7398 PWY-7398] | ||
+ | ** '''3''' reactions found over '''13''' reactions in the full pathway | ||
+ | * [[PWY-1121]], suberin monomers biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1121 PWY-1121] | ||
+ | ** '''9''' reactions found over '''19''' reactions in the full pathway | ||
+ | * [[PWY-6673]], caffeoylglucarate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6673 PWY-6673] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01943 R01943] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-6.2.1.12}} | |
− | * LIGAND- | + | {{#set: gene associated=Tiso_gene_14183|Tiso_gene_12275}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-7398|PWY-1121|PWY-6673}} |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:51, 21 March 2018
Contents
Reaction RXN-1126
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 ATP[c] + 1 trans-caffeate[c] + 1 coenzyme A[c] => 1 AMP[c] + 1 trans-caffeoyl-CoA[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14183
- Source: orthology-esiliculosus
- Gene: Tiso_gene_12275
- Source: orthology-athaliana
- Source: orthology-esiliculosus
Pathways
- PWY-7398, coumarins biosynthesis (engineered): PWY-7398
- 3 reactions found over 13 reactions in the full pathway
- PWY-1121, suberin monomers biosynthesis: PWY-1121
- 9 reactions found over 19 reactions in the full pathway
- PWY-6673, caffeoylglucarate biosynthesis: PWY-6673
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
External links
- LIGAND-RXN: