Difference between revisions of "Cis-cis-D21-39-C58-2-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_195 == * left end position: ** 4431 * transcription direction: ** POSITIVE * right end position: ** 5957 * centisome position: ** 11.757058...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_195 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] ==
−
* left end position:
+
* smiles:
−
** 4431
+
** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** (7Z)-hexadecenoyl-CoA
−
* right end position:
+
* inchi key:
−
** 5957
+
** InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
−
* centisome position:
+
* molecular weight:
−
** 11.757058    
+
** 999.899    
 
* Synonym(s):
 
* Synonym(s):
 +
** cis-hexadec-7-enoyl-CoA
 +
** (7Z)-hexadec-7-enoyl-CoA
 +
** 16:1 cis-7
 +
** 16:1(n-9)
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ATPASE-RXN]]
+
* [[RXN-17779]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN-17778]]
−
* [[CDPKIN-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[DADPKIN-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[DCDPKIN-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[DGDPKIN-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[DTDPKIN-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[DUDPKIN-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[GDPKIN-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[NUCLEOSIDE-DIP-KIN-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[NUCLEOSIDE-PHOSPHATE-KINASE-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-12195]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-12196]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-14074]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-14120]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-14228]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN0-5462]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[UDPKIN-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-7210]]
+
−
* [[PWY-7198]]
+
−
* [[PWY-7176]]
+
−
* [[PWY-7220]]
+
−
* [[PWY-7184]]
+
−
* [[PWY-7222]]
+
−
* [[PWY-7205]]
+
−
* [[PWY-7224]]
+
−
* [[PWY-7197]]
+
−
* [[PWY0-166]]
+
−
* [[PWY-7227]]
+
−
* [[PPGPPMET-PWY]]
+
−
* [[PWY-7226]]
+
−
* [[PWY-7221]]
+
−
* [[PWY-6545]]
+
−
* [[PWY-7187]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4431}}
+
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: transcription direction=POSITIVE}}
+
{{#set: common name=(7Z)-hexadecenoyl-CoA}}
−
{{#set: right end position=5957}}
+
{{#set: inchi key=InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J}}
−
{{#set: centisome position=11.757058   }}
+
{{#set: molecular weight=999.899   }}
−
{{#set: reaction associated=ATPASE-RXN|CDPKIN-RXN|DADPKIN-RXN|DCDPKIN-RXN|DGDPKIN-RXN|DTDPKIN-RXN|DUDPKIN-RXN|GDPKIN-RXN|NUCLEOSIDE-DIP-KIN-RXN|NUCLEOSIDE-PHOSPHATE-KINASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN-14074|RXN-14120|RXN-14228|RXN0-5462|UDPKIN-RXN}}
+
{{#set: common name=cis-hexadec-7-enoyl-CoA|(7Z)-hexadec-7-enoyl-CoA|16:1 cis-7|16:1(n-9)}}
−
{{#set: pathway associated=PWY-7210|PWY-7198|PWY-7176|PWY-7220|PWY-7184|PWY-7222|PWY-7205|PWY-7224|PWY-7197|PWY0-166|PWY-7227|PPGPPMET-PWY|PWY-7226|PWY-7221|PWY-6545|PWY-7187}}
+
{{#set: consumed by=RXN-17779}}
 +
{{#set: produced by=RXN-17778}}

Revision as of 15:52, 21 March 2018

Metabolite CPD-19144

  • smiles:
    • CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • (7Z)-hexadecenoyl-CoA
  • inchi key:
    • InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
  • molecular weight:
    • 999.899
  • Synonym(s):
    • cis-hexadec-7-enoyl-CoA
    • (7Z)-hexadec-7-enoyl-CoA
    • 16:1 cis-7
    • 16:1(n-9)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-cis-D21-39-C58-2-ACPs&oldid=36901"