Difference between revisions of "Tiso gene 17237"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14426 CPD-14426] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-479 RXN66-479] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14426 CPD-14426] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-479 RXN66-479] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=NDRVWKXEWNMEEO-HVGANWHPSA-J
+
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
−
* common name:
+
−
** docosapentaenoyl-CoA
+
−
* molecular weight:
+
−
** 1075.997   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl-CoA
 
−
** (7Z,10Z,13Z,16Z,19Z)-docosapentaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-13446]]
+
* With identifiers:
−
* [[RXN-16082]]
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-14926]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[CPD-14927]][c] '''+''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-13445]]
+
** 1 H2O[c] '''+''' 1 phytenal[c] '''+''' 1 NAD+[c] '''=>''' 1 phytenate[c] '''+''' 1 NADH[c] '''+''' 2 H+[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY66-389]], phytol degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-389 PWY66-389]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581114 71581114]
+
{{#set: ec number=EC-1.2.1.3}}
−
* CHEBI:
+
{{#set: in pathway=PWY66-389}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73870 73870]
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: inchi key=InChIKey=NDRVWKXEWNMEEO-HVGANWHPSA-J}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=docosapentaenoyl-CoA}}
+
−
{{#set: molecular weight=1075.997    }}
+
−
{{#set: common name=(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl-CoA|(7Z,10Z,13Z,16Z,19Z)-docosapentaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-13446|RXN-16082}}
+
−
{{#set: produced by=RXN-13445}}
+

Revision as of 15:52, 21 March 2018

Reaction RXN66-479

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 phytenal[c] + 1 NAD+[c] => 1 phytenate[c] + 1 NADH[c] + 2 H+[c]

Genes associated with this reaction

Pathways

  • PWY66-389, phytol degradation: PWY66-389
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17237&oldid=36945"