Difference between revisions of "RXN66-579"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=RGH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8348 RXN-8348] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8348 RXN-8348] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/2.10.1.1 EC-2.10.1.1] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[CPD-8122]][c] '''+''' 1 [[CPD-3]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-8123]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 molybdopterin adenine dinucleotide[c] '''+''' 1 molybdate[c] '''+''' 1 H+[c] '''=>''' 1 AMP[c] '''+''' 1 H2O[c] '''+''' 1 MoO2-molybdopterin cofactor[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_17329]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6823]], molybdenum cofactor biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823] | ||
| + | ** '''3''' reactions found over '''8''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R09735 R09735] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-2.10.1.1}} | |
| − | + | {{#set: gene associated=Tiso_gene_17329}} | |
| − | * LIGAND- | + | {{#set: in pathway=PWY-6823}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=orthology}} |
| − | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:52, 21 March 2018
Contents
Reaction RXN-8348
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 molybdopterin adenine dinucleotide[c] + 1 molybdate[c] + 1 H+[c] => 1 AMP[c] + 1 H2O[c] + 1 MoO2-molybdopterin cofactor[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_17329
- Source: orthology-esiliculosus
Pathways
- PWY-6823, molybdenum cofactor biosynthesis: PWY-6823
- 3 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- LIGAND-RXN:
