Difference between revisions of "Tiso gene 2344"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-SEROTONIN N-ACETYL-SEROTONIN] == * smiles: ** CC(=O)NCCC2(=CNC1(=C(C=C(O)C=C1)2)) * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_18857 == * right end position: ** 1147 * transcription direction: ** POSITIVE * left end position: ** 2 * centisome position: ** 7.25689350...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18857 == |
− | * | + | * right end position: |
− | ** | + | ** 1147 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2 |
− | * | + | * centisome position: |
− | ** | + | ** 7.25689350e-2 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[RXN0-1321]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6700]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1147}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=2}} | |
− | + | {{#set: centisome position=7.25689350e-2}} | |
− | + | {{#set: reaction associated=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN|RXN0-1321}} | |
− | + | {{#set: pathway associated=PWY-6700}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 15:52, 21 March 2018
Gene Tiso_gene_18857
- right end position:
- 1147
- transcription direction:
- POSITIVE
- left end position:
- 2
- centisome position:
- 7.25689350e-2
- Synonym(s):
Reactions associated
- Reaction: QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN0-1321
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation