Difference between revisions of "5-KETO-4-DEOXY-D-GLUCARATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) * inchi...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Propionyl-CoA-CO2-ligases Propionyl-CoA-CO2-ligases] == * common name: ** [propionyl-CoA:carbon...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Propionyl-CoA-CO2-ligases Propionyl-CoA-CO2-ligases] ==
−
* smiles:
+
−
** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
+
−
* inchi key:
+
−
** InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L
+
 
* common name:
 
* common name:
−
** α-D-glucose 6-phosphate
+
** [propionyl-CoA:carbon-dioxide ligase (ADP-forming)]
−
* molecular weight:
+
−
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** α-glucose 6-phosphate
 
−
** α-D-glucose-6-P
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[UG6PGT]]
 
−
* [[UG6PGTn]]
 
−
* [[G6PADHh]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[BFFS]]
+
* [[6.3.4.10-RXN]]
−
* [[RXN-1685]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[PGIA]]
 
−
* [[PGIAh]]
 
−
* [[G6PI]]
 
−
* [[G6PA_pi_th]]
 
−
* [[RXN-6182]]
 
−
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 
−
* [[PGMTh]]
 
−
* [[PGCM]]
 
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=[propionyl-CoA:carbon-dioxide ligase (ADP-forming)]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604864 21604864]
+
{{#set: produced by=6.3.4.10-RXN}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.10239175.html 10239175]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58225 58225]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00668 C00668]
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L}}
+
−
{{#set: common name=α-D-glucose 6-phosphate}}
+
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: common name=α-glucose 6-phosphate|α-D-glucose-6-P}}
+
−
{{#set: consumed by=UG6PGT|UG6PGTn|G6PADHh}}
+
−
{{#set: produced by=BFFS|RXN-1685}}
+
−
{{#set: reversible reaction associated=PGIA|PGIAh|G6PI|G6PA_pi_th|RXN-6182|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|PGMTh|PGCM}}
+

Revision as of 15:53, 21 March 2018

Metabolite Propionyl-CoA-CO2-ligases

  • common name:
    • [propionyl-CoA:carbon-dioxide ligase (ADP-forming)]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=5-KETO-4-DEOXY-D-GLUCARATE&oldid=37017"