Difference between revisions of "RXN-527"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14019 == * left end position: ** 725 * transcription direction: ** NEGATIVE * right end position: ** 4842 * centisome position: ** 12.29230...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3)) |
| − | * | + | * common name: |
| − | ** | + | ** tetraiodothyroacetate ether glucuronide |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 921.943 |
* Synonym(s): | * Synonym(s): | ||
| + | ** tetraiodothyroacetic acid ether glucuronide | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-10616]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659237 90659237] |
| − | {{#set: | + | {{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))}} |
| − | {{#set: | + | {{#set: common name=tetraiodothyroacetate ether glucuronide}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L}} |
| + | {{#set: molecular weight=921.943 }} | ||
| + | {{#set: common name=tetraiodothyroacetic acid ether glucuronide}} | ||
| + | {{#set: produced by=RXN-10616}} | ||
Revision as of 15:53, 21 March 2018
Contents
Metabolite CPD-11409
- smiles:
- C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))
- common name:
- tetraiodothyroacetate ether glucuronide
- inchi key:
- InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L
- molecular weight:
- 921.943
- Synonym(s):
- tetraiodothyroacetic acid ether glucuronide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))" cannot be used as a page name in this wiki.
