Difference between revisions of "Tiso gene 8216"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_17795 == * Synonym(s): == Reactions associated == * RXN-8443 ** pantograph-athaliana == Pathways associated == * PWY-5381...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] == * smiles: ** CS(=O)CCC([N+])C(=O)[O-] * common name: ** L-methionine-(R)-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] == |
+ | * smiles: | ||
+ | ** CS(=O)CCC([N+])C(=O)[O-] | ||
+ | * common name: | ||
+ | ** L-methionine-(R)-S-oxide | ||
+ | * inchi key: | ||
+ | ** InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N | ||
+ | * molecular weight: | ||
+ | ** 165.207 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** L-methionine-R-sulfoxide | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN | + | * [[1.8.4.14-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11862103 11862103] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58773 58773] | ||
+ | * BIGG : metsox_R__L | ||
+ | {{#set: smiles=CS(=O)CCC([N+])C(=O)[O-]}} | ||
+ | {{#set: common name=L-methionine-(R)-S-oxide}} | ||
+ | {{#set: inchi key=InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N}} | ||
+ | {{#set: molecular weight=165.207 }} | ||
+ | {{#set: common name=L-methionine-R-sulfoxide}} | ||
+ | {{#set: consumed by=1.8.4.14-RXN}} |
Revision as of 15:53, 21 March 2018
Contents
Metabolite CPD-8990
- smiles:
- CS(=O)CCC([N+])C(=O)[O-]
- common name:
- L-methionine-(R)-S-oxide
- inchi key:
- InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N
- molecular weight:
- 165.207
- Synonym(s):
- L-methionine-R-sulfoxide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CS(=O)CCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.