Difference between revisions of "Tiso gene 18652"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE PANTOTHENATE] == * smiles: ** CC(C)(CO)C(O)C(=O)NCCC(=O)[O-] * inchi key: ** InChI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-N-Ac-L-cysteine N-terminal-N-Ac-L-cysteine] == * common name: ** an N-terminal N&alp...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-N-Ac-L-cysteine N-terminal-N-Ac-L-cysteine] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an N-terminal Nα-acetyl-L-cysteinyl-[protein] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a [protein] N-terminal Nα-acetyl-L-cysteine |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17861]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an N-terminal Nα-acetyl-L-cysteinyl-[protein]}} | |
| − | + | {{#set: common name=a [protein] N-terminal Nα-acetyl-L-cysteine}} | |
| − | + | {{#set: produced by=RXN-17861}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: produced by= | + | |
Revision as of 15:53, 21 March 2018
Contents
Metabolite N-terminal-N-Ac-L-cysteine
- common name:
- an N-terminal Nα-acetyl-L-cysteinyl-[protein]
- Synonym(s):
- a [protein] N-terminal Nα-acetyl-L-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an N-terminal Nα-acetyl-L-cysteinyl-[protein" cannot be used as a page name in this wiki.
"a [protein] N-terminal Nα-acetyl-L-cysteine" cannot be used as a page name in this wiki.
