Difference between revisions of "Reduced-adrenal-ferredoxins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-206 CPD-206] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == * smiles: ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O * commo...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** melibionate |
+ | * inchi key: | ||
+ | ** InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 357.291 |
* Synonym(s): | * Synonym(s): | ||
+ | ** melibionic acid | ||
+ | ** 6-O-α-D-galactopyranosyl-D-gluconic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-17754]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202771 25202771] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75299 75299] |
− | + | {{#set: smiles=C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O}} | |
− | + | {{#set: common name=melibionate}} | |
− | + | {{#set: inchi key=InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M}} | |
− | {{#set: smiles= | + | {{#set: molecular weight=357.291 }} |
− | {{#set: | + | {{#set: common name=melibionic acid|6-O-α-D-galactopyranosyl-D-gluconic acid}} |
− | {{#set: | + | {{#set: consumed by=RXN-17754}} |
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:54, 21 March 2018
Contents
Metabolite CPD-3801
- smiles:
- C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
- common name:
- melibionate
- inchi key:
- InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
- molecular weight:
- 357.291
- Synonym(s):
- melibionic acid
- 6-O-α-D-galactopyranosyl-D-gluconic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O" cannot be used as a page name in this wiki.