Difference between revisions of "RXN-7663"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5165 CPD-5165] == * common name: ** α-D-Man-(1→2)-α-D-Man-(1→2)-&alph...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] == * smiles: ** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] == |
+ | * smiles: | ||
+ | ** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2) | ||
* common name: | * common name: | ||
− | ** | + | ** 3'-ketolactose |
+ | * inchi key: | ||
+ | ** InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N | ||
+ | * molecular weight: | ||
+ | ** 340.283 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[KETOLACTOSE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * KEGG-GLYCAN : G10531 |
− | {{#set: common name= | + | * HMDB : HMDB01030 |
− | {{#set: consumed by= | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27571 27571] | |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201057 25201057] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05403 C05403] | ||
+ | {{#set: smiles=C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)}} | ||
+ | {{#set: common name=3'-ketolactose}} | ||
+ | {{#set: inchi key=InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N}} | ||
+ | {{#set: molecular weight=340.283 }} | ||
+ | {{#set: common name=3'-dehydro-β-D-galactosyl-β-D-glucopyranoside}} | ||
+ | {{#set: consumed by=KETOLACTOSE-RXN}} |
Revision as of 15:54, 21 March 2018
Contents
Metabolite 3-KETOLACTOSE
- smiles:
- C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)
- common name:
- 3'-ketolactose
- inchi key:
- InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N
- molecular weight:
- 340.283
- Synonym(s):
- 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links